C13H17NO7 — CID 11709194
dimethyl (3aS,6R,6aR)-1,3-dioxo-6-propan-2-yl-3a,5,6,6a-tetrahydrofuro[3,4-c]pyrrole-4,4-dicarboxylate (PubChem CID 11709194) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is dimethyl (3aS,6R,6aR)-1,3-dioxo-6-propan-2-yl-3a,5,6,6a-tetrahydrofuro[3,4-c]pyrrole-4,4-dicarboxylate.
| Compound Name | dimethyl (3aS,6R,6aR)-1,3-dioxo-6-propan-2-yl-3a,5,6,6a-tetrahydrofuro[3,4-c]pyrrole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 11709194 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | dimethyl (3aS,6R,6aR)-1,3-dioxo-6-propan-2-yl-3a,5,6,6a-tetrahydrofuro[3,4-c]pyrrole-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)N[C@H](C(C)C)[C@@H]2C(=O)OC(=O)[C@@H]21 |
| InChI | InChI=1S/C13H17NO7/c1-5(2)8-6-7(10(16)21-9(6)15)13(14-8,11(17)19-3)12(18)20-4/h5-8,14H,1-4H3/t6-,7-,8-/m1/s1 |
| InChIKey | GWOKYXDGQZIQND-BWZBUEFSSA-N |
| XLogP | -0.99 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|