C10H12N4OS — CID 117091985
2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole-5-carboxamide (PubChem CID 117091985) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117091985 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C)c1-c1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C10H12N4OS/c1-5-8(6(2)14(3)13-5)10-12-4-7(16-10)9(11)15/h4H,1-3H3,(H2,11,15) |
| InChIKey | CIHMZRJBWUBPRT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |