C22H25F3N6O — CID 117092046
2-N,2-N-diethyl-6-N-(2-phenoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117092046) has the molecular formula C22H25F3N6O and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-N-(2-phenoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-6-N-(2-phenoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117092046 |
| Molecular Formula | C22H25F3N6O |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-N,2-N-diethyl-6-N-(2-phenoxyethyl)-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCCOc2ccccc2)nc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C22H25F3N6O/c1-3-31(4-2)21-29-19(26-14-15-32-18-8-6-5-7-9-18)28-20(30-21)27-17-12-10-16(11-13-17)22(23,24)25/h5-13H,3-4,14-15H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | GWZLMCSDOURYKA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|