C23H27F3N6O — CID 117092076
2-N,2-N-diethyl-6-N-[2-(4-methoxyphenyl)ethyl]-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117092076) has the molecular formula C23H27F3N6O and a molecular weight of 460.50 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-N-[2-(4-methoxyphenyl)ethyl]-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-6-N-[2-(4-methoxyphenyl)ethyl]-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117092076 |
| Molecular Formula | C23H27F3N6O |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-N,2-N-diethyl-6-N-[2-(4-methoxyphenyl)ethyl]-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCCc2ccc(OC)cc2)nc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C23H27F3N6O/c1-4-32(5-2)22-30-20(27-15-14-16-6-12-19(33-3)13-7-16)29-21(31-22)28-18-10-8-17(9-11-18)23(24,25)26/h6-13H,4-5,14-15H2,1-3H3,(H2,27,28,29,30,31) |
| InChIKey | VBAWNJBAMQMVIS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |