C21H23F3N6 — CID 117092161
6-N-benzyl-2-N,2-N-diethyl-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117092161) has the molecular formula C21H23F3N6 and a molecular weight of 416.45 g/mol. Its IUPAC name is 6-N-benzyl-2-N,2-N-diethyl-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-benzyl-2-N,2-N-diethyl-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117092161 |
| Molecular Formula | C21H23F3N6 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 6-N-benzyl-2-N,2-N-diethyl-4-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCc2ccccc2)nc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H23F3N6/c1-3-30(4-2)20-28-18(25-14-15-8-6-5-7-9-15)27-19(29-20)26-17-12-10-16(11-13-17)21(22,23)24/h5-13H,3-4,14H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | QUWVJBVMFDHSPX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |