C33H41N7O2 — CID 117092955
1-[9-cyclohexyl-6-(4-phenoxyanilino)purin-2-yl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 117092955) has the molecular formula C33H41N7O2 and a molecular weight of 567.74 g/mol. Its IUPAC name is 1-[9-cyclohexyl-6-(4-phenoxyanilino)purin-2-yl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[9-cyclohexyl-6-(4-phenoxyanilino)purin-2-yl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 117092955 |
| Molecular Formula | C33H41N7O2 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | 1-[9-cyclohexyl-6-(4-phenoxyanilino)purin-2-yl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2nc(Nc3ccc(Oc4ccccc4)cc3)c3ncn(C4CCCCC4)c3n2)C1 |
| InChI | InChI=1S/C33H41N7O2/c1-3-38(4-2)32(41)24-12-11-21-39(22-24)33-36-30(29-31(37-33)40(23-34-29)26-13-7-5-8-14-26)35-25-17-19-28(20-18-25)42-27-15-9-6-10-16-27/h6,9-10,15-20,23-24,26H,3-5,7-8,11-14,21-22H2,1-2H3,(H,35,36,37) |
| InChIKey | RSTHATUQWYLNST-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |