C18H19N5O — CID 117093089
5-methyl-4-N-(2-phenoxyethyl)-2-N-pyridin-4-ylpyrimidine-2,4-diamine (PubChem CID 117093089) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-methyl-4-N-(2-phenoxyethyl)-2-N-pyridin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 5-methyl-4-N-(2-phenoxyethyl)-2-N-pyridin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117093089 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-methyl-4-N-(2-phenoxyethyl)-2-N-pyridin-4-ylpyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccncc2)nc1NCCOc1ccccc1 |
| InChI | InChI=1S/C18H19N5O/c1-14-13-21-18(22-15-7-9-19-10-8-15)23-17(14)20-11-12-24-16-5-3-2-4-6-16/h2-10,13H,11-12H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | GJERWEKPOIIJFT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|