C21H31N7O3 — CID 117093243
4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 117093243) has the molecular formula C21H31N7O3 and a molecular weight of 429.53 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117093243 |
| Molecular Formula | C21H31N7O3 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCCN2CCOCC2)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H31N7O3/c1-3-28(4-2)21-25-19(22-7-8-27-9-11-29-12-10-27)24-20(26-21)23-14-16-5-6-17-18(13-16)31-15-30-17/h5-6,13H,3-4,7-12,14-15H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | VLTCFJXRYMKGFG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |