C19H20N4O4 — CID 117093506
4-methoxy-6-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 117093506) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-methoxy-6-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 117093506 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-methoxy-6-phenyl-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2cc(OC)c(OC)c(OC)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H20N4O4/c1-24-14-10-13(11-15(25-2)16(14)26-3)20-18-21-17(22-19(23-18)27-4)12-8-6-5-7-9-12/h5-11H,1-4H3,(H,20,21,22,23) |
| InChIKey | ZPUHAMGZEYWESP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |