About 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole
2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole (PubChem CID 11709446) has the molecular formula C17H8F3NS
and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole |
| PubChem CID | 11709446 |
| Molecular Formula | C17H8F3NS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole |
| SMILES | Fc1cccc(C#Cc2csc(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C17H8F3NS/c18-13-3-1-2-11(6-13)4-5-16-10-22-17(21-16)12-7-14(19)9-15(20)8-12/h1-3,6-10H |
| InChIKey | GTHLADQNIASGBG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole?
The IUPAC name of 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole (CID 11709446) is 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole.
What is the SMILES notation for 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole?
The canonical SMILES for 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole is Fc1cccc(C#Cc2csc(-c3cc(F)cc(F)c3)n2)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole?
The InChIKey is GTHLADQNIASGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8F3NS/c18-13-3-1-2-11(6-13)4-5-16-10-22-17(21-16)12-7-14(19)9-15(20)8-12/h1-3,6-10H.
What are the key properties of 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole?
2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole has a molecular weight of 315.32 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-4-[2-(3-fluorophenyl)ethynyl]-1,3-thiazole is sourced from PubChem (CID 11709446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).