C15H20F3N3O — CID 11709448
2-cyclopropyl-7-methyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine (PubChem CID 11709448) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-cyclopropyl-7-methyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine.
| Compound Name | 2-cyclopropyl-7-methyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 11709448 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-cyclopropyl-7-methyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
| SMILES | CN1CCc2nc(C3CC3)nc(OCCC(F)(F)F)c2CC1 |
| InChI | InChI=1S/C15H20F3N3O/c1-21-7-4-11-12(5-8-21)19-13(10-2-3-10)20-14(11)22-9-6-15(16,17)18/h10H,2-9H2,1H3 |
| InChIKey | HCGMBLPOFUUPLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |