C23H25F3N6O2 — CID 117094556
4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117094556) has the molecular formula C23H25F3N6O2 and a molecular weight of 474.49 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117094556 |
| Molecular Formula | C23H25F3N6O2 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCc2cccc(C(F)(F)F)c2)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C23H25F3N6O2/c1-3-32(4-2)22-30-20(27-12-15-6-5-7-17(10-15)23(24,25)26)29-21(31-22)28-13-16-8-9-18-19(11-16)34-14-33-18/h5-11H,3-4,12-14H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | GKJQRCDTGCUTLR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |