C19H18F2O2 — CID 11709462
1-[(1E)-1-(2,4-difluorophenyl)penta-1,4-dien-3-yl]-2,4-dimethoxybenzene (PubChem CID 11709462) has the molecular formula C19H18F2O2 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-[(1E)-1-(2,4-difluorophenyl)penta-1,4-dien-3-yl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(1E)-1-(2,4-difluorophenyl)penta-1,4-dien-3-yl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 11709462 |
| Molecular Formula | C19H18F2O2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[(1E)-1-(2,4-difluorophenyl)penta-1,4-dien-3-yl]-2,4-dimethoxybenzene |
| SMILES | C=CC(/C=C/c1ccc(F)cc1F)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H18F2O2/c1-4-13(5-6-14-7-8-15(20)11-18(14)21)17-10-9-16(22-2)12-19(17)23-3/h4-13H,1H2,2-3H3/b6-5+ |
| InChIKey | AXWZWNGDWJLCGA-AATRIKPKSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|