C14H16Cl2N3O+ — CID 117094728
(2R)-2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-2-ium-2-yl)propan-2-ol (PubChem CID 117094728) has the molecular formula C14H16Cl2N3O+ and a molecular weight of 313.21 g/mol. Its IUPAC name is (2R)-2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-2-ium-2-yl)propan-2-ol.
| Compound Name | (2R)-2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-2-ium-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 117094728 |
| Molecular Formula | C14H16Cl2N3O+ |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2R)-2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1H-1,2,4-triazol-2-ium-2-yl)propan-2-ol |
| SMILES | O[C@](Cc1ccccc1Cl)(C[n+]1cnc[nH]1)C1(Cl)CC1 |
| InChI | InChI=1S/C14H15Cl2N3O/c15-12-4-2-1-3-11(12)7-14(20,13(16)5-6-13)8-19-10-17-9-18-19/h1-4,9-10,20H,5-8H2/p+1/t14-/m1/s1 |
| InChIKey | HHUQPWODPBDTLI-CQSZACIVSA-O |
| XLogP | 2.10 |
| TPSA | 52.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|