About 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one
4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one (PubChem CID 117094769) has the molecular formula C18H23ClN4O2
and a molecular weight of 362.86 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one |
| PubChem CID | 117094769 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one |
| SMILES | Cc1ccc(C)c(-n2ncc(NCCN3CCOCC3)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-13-3-4-14(2)16(11-13)23-18(24)17(19)15(12-21-23)20-5-6-22-7-9-25-10-8-22/h3-4,11-12,20H,5-10H2,1-2H3 |
| InChIKey | PPCJCEMFTKGISF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one?
The IUPAC name of 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one (CID 117094769) is 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one.
What is the SMILES notation for 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one?
The canonical SMILES for 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one is Cc1ccc(C)c(-n2ncc(NCCN3CCOCC3)c(Cl)c2=O)c1.
What is the InChIKey of 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one?
The InChIKey is PPCJCEMFTKGISF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN4O2/c1-13-3-4-14(2)16(11-13)23-18(24)17(19)15(12-21-23)20-5-6-22-7-9-25-10-8-22/h3-4,11-12,20H,5-10H2,1-2H3.
What are the key properties of 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one?
4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one has a molecular weight of 362.86 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,5-dimethylphenyl)-5-(2-morpholin-4-ylethylamino)pyridazin-3-one is sourced from PubChem (CID 117094769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).