About [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate
[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 11709504) has the molecular formula C16H34O4Si
and a molecular weight of 318.53 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate |
| PubChem CID | 11709504 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)C[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C16H34O4Si/c1-12(11-19-21(8,9)16(5,6)7)20-14(18)10-13(17)15(2,3)4/h12-13,17H,10-11H2,1-9H3/t12-,13+/m0/s1 |
| InChIKey | BWDJJKFFCUXMKW-QWHCGFSZSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate?
The IUPAC name of [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate (CID 11709504) is [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate.
What is the SMILES notation for [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate?
The canonical SMILES for [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate is C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)C[C@@H](O)C(C)(C)C.
What is the InChIKey of [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate?
The InChIKey is BWDJJKFFCUXMKW-QWHCGFSZSA-N. The full InChI is InChI=1S/C16H34O4Si/c1-12(11-19-21(8,9)16(5,6)7)20-14(18)10-13(17)15(2,3)4/h12-13,17H,10-11H2,1-9H3/t12-,13+/m0/s1.
What are the key properties of [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate?
[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate has a molecular weight of 318.53 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl] (3R)-3-hydroxy-4,4-dimethylpentanoate is sourced from PubChem (CID 11709504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).