C17H17F2NO3 — CID 11709545
benzyl N-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-yl]carbamate (PubChem CID 11709545) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11709545 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | benzyl N-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)[C@H](O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2NO3/c1-11(16(21)14-8-7-13(18)9-15(14)19)20-17(22)23-10-12-5-3-2-4-6-12/h2-9,11,16,21H,10H2,1H3,(H,20,22)/t11-,16-/m0/s1 |
| InChIKey | IGACTJZIQKZRJD-ZBEGNZNMSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |