C10H9F2NO3 — CID 117095633
3-(6-amino-2,3-difluorophenoxy)oxolan-2-one (PubChem CID 117095633) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one.
| Compound Name | 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one |
|---|---|
| PubChem CID | 117095633 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one |
| SMILES | Nc1ccc(F)c(F)c1OC1CCOC1=O |
| InChI | InChI=1S/C10H9F2NO3/c11-5-1-2-6(13)9(8(5)12)16-7-3-4-15-10(7)14/h1-2,7H,3-4,13H2 |
| InChIKey | NTBZXXFBGGCPQD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|