About 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one
3-(6-amino-2,3-difluorophenoxy)oxolan-2-one (PubChem CID 117095633) has the molecular formula C10H9F2NO3
and a molecular weight of 229.18 g/mol. Its IUPAC name is 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one.
Molecular Properties
| Compound Name | 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one |
| PubChem CID | 117095633 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one |
| SMILES | Nc1ccc(F)c(F)c1OC1CCOC1=O |
| InChI | InChI=1S/C10H9F2NO3/c11-5-1-2-6(13)9(8(5)12)16-7-3-4-15-10(7)14/h1-2,7H,3-4,13H2 |
| InChIKey | NTBZXXFBGGCPQD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one?
The IUPAC name of 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one (CID 117095633) is 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one.
What is the SMILES notation for 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one?
The canonical SMILES for 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one is Nc1ccc(F)c(F)c1OC1CCOC1=O.
What is the InChIKey of 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one?
The InChIKey is NTBZXXFBGGCPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO3/c11-5-1-2-6(13)9(8(5)12)16-7-3-4-15-10(7)14/h1-2,7H,3-4,13H2.
What are the key properties of 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one?
3-(6-amino-2,3-difluorophenoxy)oxolan-2-one has a molecular weight of 229.18 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-2,3-difluorophenoxy)oxolan-2-one is sourced from PubChem (CID 117095633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).