About 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one
5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 11709566) has the molecular formula C18H14N2O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 11709566 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1c(-c2csc(-c3ccccc3)n2)ccc2c1NC(=O)CO2 |
| InChI | InChI=1S/C18H14N2O2S/c1-11-13(7-8-15-17(11)20-16(21)9-22-15)14-10-23-18(19-14)12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | JYVIOWQPOWMMRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (CID 11709566) is 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one is Cc1c(-c2csc(-c3ccccc3)n2)ccc2c1NC(=O)CO2.
What is the InChIKey of 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
The InChIKey is JYVIOWQPOWMMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2S/c1-11-13(7-8-15-17(11)20-16(21)9-22-15)14-10-23-18(19-14)12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,20,21).
What are the key properties of 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one?
5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one has a molecular weight of 322.39 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 11709566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).