About 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one
7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one (PubChem CID 11709766) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one.
Molecular Properties
| Compound Name | 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one |
| PubChem CID | 11709766 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H22N2O2/c24-19(16-10-2-1-5-11-17-12-6-3-7-13-17)21-23-22-20(25-21)18-14-8-4-9-15-18/h3-4,6-9,12-15H,1-2,5,10-11,16H2 |
| InChIKey | HQZDZQUKZOMFPX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one?
The IUPAC name of 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one (CID 11709766) is 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one.
What is the SMILES notation for 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one?
The canonical SMILES for 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one is O=C(CCCCCCc1ccccc1)c1nnc(-c2ccccc2)o1.
What is the InChIKey of 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one?
The InChIKey is HQZDZQUKZOMFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c24-19(16-10-2-1-5-11-17-12-6-3-7-13-17)21-23-22-20(25-21)18-14-8-4-9-15-18/h3-4,6-9,12-15H,1-2,5,10-11,16H2.
What are the key properties of 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one?
7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one has a molecular weight of 334.42 g/mol, XLogP of 5.11, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)heptan-1-one is sourced from PubChem (CID 11709766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).