About 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile
5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile (PubChem CID 11709793) has the molecular formula C19H17FN4O
and a molecular weight of 336.37 g/mol. Its IUPAC name is 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile |
| PubChem CID | 11709793 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile |
| SMILES | CN1C(=O)C[C@@](C)(c2cccc(-c3ccc(F)c(C#N)c3)c2)N=C1N |
| InChI | InChI=1S/C19H17FN4O/c1-19(10-17(25)24(2)18(22)23-19)15-5-3-4-12(9-15)13-6-7-16(20)14(8-13)11-21/h3-9H,10H2,1-2H3,(H2,22,23)/t19-/m0/s1 |
| InChIKey | PAUNHJAXXDGXIN-IBGZPJMESA-N |
| XLogP | 2.76 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile?
The IUPAC name of 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile (CID 11709793) is 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile.
What is the SMILES notation for 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile?
The canonical SMILES for 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile is CN1C(=O)C[C@@](C)(c2cccc(-c3ccc(F)c(C#N)c3)c2)N=C1N.
What is the InChIKey of 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile?
The InChIKey is PAUNHJAXXDGXIN-IBGZPJMESA-N. The full InChI is InChI=1S/C19H17FN4O/c1-19(10-17(25)24(2)18(22)23-19)15-5-3-4-12(9-15)13-6-7-16(20)14(8-13)11-21/h3-9H,10H2,1-2H3,(H2,22,23)/t19-/m0/s1.
What are the key properties of 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile?
5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile has a molecular weight of 336.37 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]phenyl]-2-fluorobenzonitrile is sourced from PubChem (CID 11709793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).