C13H14FNO3 — CID 117098768
1-[1-(2,3-dihydroxypropyl)-7-fluoroindol-3-yl]ethanone (PubChem CID 117098768) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 1-[1-(2,3-dihydroxypropyl)-7-fluoroindol-3-yl]ethanone.
| Compound Name | 1-[1-(2,3-dihydroxypropyl)-7-fluoroindol-3-yl]ethanone |
|---|---|
| PubChem CID | 117098768 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-[1-(2,3-dihydroxypropyl)-7-fluoroindol-3-yl]ethanone |
| SMILES | CC(=O)c1cn(CC(O)CO)c2c(F)cccc12 |
| InChI | InChI=1S/C13H14FNO3/c1-8(17)11-6-15(5-9(18)7-16)13-10(11)3-2-4-12(13)14/h2-4,6,9,16,18H,5,7H2,1H3 |
| InChIKey | CKRNDAJROHDWTO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |