5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid

C16H19NO2S — CID 117098948

IUPAC5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid
SMILESCCC(CC)c1nc(C(=O)O)c(Cc2ccccc2)s1
InChIInChI=1S/C16H19NO2S/c1-3-12(4-2)15-17-14(16(18)19)13(20-15)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,18,19)
InChIKeyUVZGTGRHRXOKPO-UHFFFAOYSA-N
MW289.40 g/mol
LogP4.34
Rot. Bonds6

About 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid

5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 117098948) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid
PubChem CID117098948
Molecular FormulaC16H19NO2S
Molecular Weight289.40 g/mol
Exact Mass289.11
IUPAC Name5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid
SMILESCCC(CC)c1nc(C(=O)O)c(Cc2ccccc2)s1
InChIInChI=1S/C16H19NO2S/c1-3-12(4-2)15-17-14(16(18)19)13(20-15)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,18,19)
InChIKeyUVZGTGRHRXOKPO-UHFFFAOYSA-N
XLogP4.34
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.40
LogP ≤ 54.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid (CID 117098948) is 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid is CCC(CC)c1nc(C(=O)O)c(Cc2ccccc2)s1.
What is the InChIKey of 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid?
The InChIKey is UVZGTGRHRXOKPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-3-12(4-2)15-17-14(16(18)19)13(20-15)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,18,19).
What are the key properties of 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid?
5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid has a molecular weight of 289.40 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-pentan-3-yl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 117098948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).