C19H21NO3 — CID 117100164
3-[(4-piperidin-3-ylphenoxy)methyl]benzoic acid (PubChem CID 117100164) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-[(4-piperidin-3-ylphenoxy)methyl]benzoic acid.
| Compound Name | 3-[(4-piperidin-3-ylphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 117100164 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[(4-piperidin-3-ylphenoxy)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(C3CCCNC3)cc2)c1 |
| InChI | InChI=1S/C19H21NO3/c21-19(22)16-4-1-3-14(11-16)13-23-18-8-6-15(7-9-18)17-5-2-10-20-12-17/h1,3-4,6-9,11,17,20H,2,5,10,12-13H2,(H,21,22) |
| InChIKey | LTCOQLBOULZMSH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |