C17H27NO4 — CID 117100276
3-(4-piperidin-3-yl-2-propan-2-yloxyphenoxy)propane-1,2-diol (PubChem CID 117100276) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(4-piperidin-3-yl-2-propan-2-yloxyphenoxy)propane-1,2-diol.
| Compound Name | 3-(4-piperidin-3-yl-2-propan-2-yloxyphenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 117100276 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-(4-piperidin-3-yl-2-propan-2-yloxyphenoxy)propane-1,2-diol |
| SMILES | CC(C)Oc1cc(C2CCCNC2)ccc1OCC(O)CO |
| InChI | InChI=1S/C17H27NO4/c1-12(2)22-17-8-13(14-4-3-7-18-9-14)5-6-16(17)21-11-15(20)10-19/h5-6,8,12,14-15,18-20H,3-4,7,9-11H2,1-2H3 |
| InChIKey | HZQAWJPCQKVHHY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |