C13H20N4S — CID 117102363
4-(cyclopentylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione (PubChem CID 117102363) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 4-(cyclopentylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione.
| Compound Name | 4-(cyclopentylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
|---|---|
| PubChem CID | 117102363 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-(cyclopentylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
| SMILES | S=c1nc(NC2CCCC2)c2c([nH]1)CCNCC2 |
| InChI | InChI=1S/C13H20N4S/c18-13-16-11-6-8-14-7-5-10(11)12(17-13)15-9-3-1-2-4-9/h9,14H,1-8H2,(H2,15,16,17,18) |
| InChIKey | BPQSCBNPLQGBCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|