C11H16N4S — CID 117102367
4-(azetidin-1-yl)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione (PubChem CID 117102367) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione.
| Compound Name | 4-(azetidin-1-yl)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
|---|---|
| PubChem CID | 117102367 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-(azetidin-1-yl)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
| SMILES | S=c1nc(N2CCC2)c2c([nH]1)CCNCC2 |
| InChI | InChI=1S/C11H16N4S/c16-11-13-9-3-5-12-4-2-8(9)10(14-11)15-6-1-7-15/h12H,1-7H2,(H,13,14,16) |
| InChIKey | BEYKVCOHVNSJPY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|