C14H15FN4O — CID 117102383
4-(4-fluoroanilino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one (PubChem CID 117102383) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-(4-fluoroanilino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one.
| Compound Name | 4-(4-fluoroanilino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one |
|---|---|
| PubChem CID | 117102383 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-(4-fluoroanilino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one |
| SMILES | O=c1nc(Nc2ccc(F)cc2)c2c([nH]1)CCNCC2 |
| InChI | InChI=1S/C14H15FN4O/c15-9-1-3-10(4-2-9)17-13-11-5-7-16-8-6-12(11)18-14(20)19-13/h1-4,16H,5-8H2,(H2,17,18,19,20) |
| InChIKey | YKSLVOVWULIGIR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |