C8H11N3O3 — CID 117102906
6-(ethylamino)-3-methoxypyridazine-4-carboxylic acid (PubChem CID 117102906) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-(ethylamino)-3-methoxypyridazine-4-carboxylic acid.
| Compound Name | 6-(ethylamino)-3-methoxypyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 117102906 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 6-(ethylamino)-3-methoxypyridazine-4-carboxylic acid |
| SMILES | CCNc1cc(C(=O)O)c(OC)nn1 |
| InChI | InChI=1S/C8H11N3O3/c1-3-9-6-4-5(8(12)13)7(14-2)11-10-6/h4H,3H2,1-2H3,(H,9,10)(H,12,13) |
| InChIKey | RKDAFAPJHXOPEG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |