About 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine
3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 117103217) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 117103217 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1ccnc2c(CC3CCCCS3(=O)=O)cnn12 |
| InChI | InChI=1S/C12H16N4O2S/c13-11-4-5-14-12-9(8-15-16(11)12)7-10-3-1-2-6-19(10,17)18/h4-5,8,10H,1-3,6-7,13H2 |
| InChIKey | LKLFSWRAJSMISI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine (CID 117103217) is 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine is Nc1ccnc2c(CC3CCCCS3(=O)=O)cnn12.
What is the InChIKey of 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is LKLFSWRAJSMISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c13-11-4-5-14-12-9(8-15-16(11)12)7-10-3-1-2-6-19(10,17)18/h4-5,8,10H,1-3,6-7,13H2.
What are the key properties of 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine?
3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 280.35 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothian-2-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 117103217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).