About 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde
4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde (PubChem CID 11710340) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde |
| PubChem CID | 11710340 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde |
| SMILES | COc1cc(Nc2cncc(-c3ccc(C=O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N3O4/c1-25-17-8-15(9-18(26-2)20(17)27-3)22-19-11-21-10-16(23-19)14-6-4-13(12-24)5-7-14/h4-12H,1-3H3,(H,22,23) |
| InChIKey | NCCTXSAAPZYIRK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde?
The IUPAC name of 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde (CID 11710340) is 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde.
What is the SMILES notation for 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde?
The canonical SMILES for 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde is COc1cc(Nc2cncc(-c3ccc(C=O)cc3)n2)cc(OC)c1OC.
What is the InChIKey of 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde?
The InChIKey is NCCTXSAAPZYIRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-25-17-8-15(9-18(26-2)20(17)27-3)22-19-11-21-10-16(23-19)14-6-4-13(12-24)5-7-14/h4-12H,1-3H3,(H,22,23).
What are the key properties of 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde?
4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde has a molecular weight of 365.39 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]benzaldehyde is sourced from PubChem (CID 11710340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).