C23H19N3O2 — CID 11710424
N-(1,3-diphenylpyrazol-5-yl)-3-methoxybenzamide (PubChem CID 11710424) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-3-methoxybenzamide.
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 11710424 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(-c3ccccc3)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H19N3O2/c1-28-20-14-8-11-18(15-20)23(27)24-22-16-21(17-9-4-2-5-10-17)25-26(22)19-12-6-3-7-13-19/h2-16H,1H3,(H,24,27) |
| InChIKey | GCBGMFFPAAZMON-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |