C9H13N3 — CID 117105038
3-(1-methylpyrrolidin-3-yl)pyridazine (PubChem CID 117105038) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-3-yl)pyridazine.
| Compound Name | 3-(1-methylpyrrolidin-3-yl)pyridazine |
|---|---|
| PubChem CID | 117105038 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-(1-methylpyrrolidin-3-yl)pyridazine |
| SMILES | CN1CCC(c2cccnn2)C1 |
| InChI | InChI=1S/C9H13N3/c1-12-6-4-8(7-12)9-3-2-5-10-11-9/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | UKVXNCMFQABXJA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |