C11H17ClN4 — CID 117105087
4-chloro-6-(1-propan-2-ylpyrrolidin-3-yl)pyridazin-3-amine (PubChem CID 117105087) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 4-chloro-6-(1-propan-2-ylpyrrolidin-3-yl)pyridazin-3-amine.
| Compound Name | 4-chloro-6-(1-propan-2-ylpyrrolidin-3-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 117105087 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-chloro-6-(1-propan-2-ylpyrrolidin-3-yl)pyridazin-3-amine |
| SMILES | CC(C)N1CCC(c2cc(Cl)c(N)nn2)C1 |
| InChI | InChI=1S/C11H17ClN4/c1-7(2)16-4-3-8(6-16)10-5-9(12)11(13)15-14-10/h5,7-8H,3-4,6H2,1-2H3,(H2,13,15) |
| InChIKey | QXZRWVHTGINRJC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |