C11H18N4 — CID 117105891
6-(1-ethylpiperidin-2-yl)pyridazin-3-amine (PubChem CID 117105891) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-(1-ethylpiperidin-2-yl)pyridazin-3-amine.
| Compound Name | 6-(1-ethylpiperidin-2-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 117105891 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 6-(1-ethylpiperidin-2-yl)pyridazin-3-amine |
| SMILES | CCN1CCCCC1c1ccc(N)nn1 |
| InChI | InChI=1S/C11H18N4/c1-2-15-8-4-3-5-10(15)9-6-7-11(12)14-13-9/h6-7,10H,2-5,8H2,1H3,(H2,12,14) |
| InChIKey | DSBRYGJAXOCTDP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |