C9H12N2O2 — CID 117105951
3-(oxolan-2-ylmethyl)-1H-pyridazin-6-one (PubChem CID 117105951) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-1H-pyridazin-6-one.
| Compound Name | 3-(oxolan-2-ylmethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 117105951 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-1H-pyridazin-6-one |
| SMILES | O=c1ccc(CC2CCCO2)n[nH]1 |
| InChI | InChI=1S/C9H12N2O2/c12-9-4-3-7(10-11-9)6-8-2-1-5-13-8/h3-4,8H,1-2,5-6H2,(H,11,12) |
| InChIKey | WXVSBLLAKMEIPP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |