C12H19N3 — CID 117106303
3-[(1-ethylpiperidin-3-yl)methyl]pyridazine (PubChem CID 117106303) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-[(1-ethylpiperidin-3-yl)methyl]pyridazine.
| Compound Name | 3-[(1-ethylpiperidin-3-yl)methyl]pyridazine |
|---|---|
| PubChem CID | 117106303 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-[(1-ethylpiperidin-3-yl)methyl]pyridazine |
| SMILES | CCN1CCCC(Cc2cccnn2)C1 |
| InChI | InChI=1S/C12H19N3/c1-2-15-8-4-5-11(10-15)9-12-6-3-7-13-14-12/h3,6-7,11H,2,4-5,8-10H2,1H3 |
| InChIKey | SRQNKZCYANZJCL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |