C13H10BrF3N2O — CID 117106723
4-bromo-3-methoxy-6-[[2-(trifluoromethyl)phenyl]methyl]pyridazine (PubChem CID 117106723) has the molecular formula C13H10BrF3N2O and a molecular weight of 347.13 g/mol. Its IUPAC name is 4-bromo-3-methoxy-6-[[2-(trifluoromethyl)phenyl]methyl]pyridazine.
| Compound Name | 4-bromo-3-methoxy-6-[[2-(trifluoromethyl)phenyl]methyl]pyridazine |
|---|---|
| PubChem CID | 117106723 |
| Molecular Formula | C13H10BrF3N2O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 4-bromo-3-methoxy-6-[[2-(trifluoromethyl)phenyl]methyl]pyridazine |
| SMILES | COc1nnc(Cc2ccccc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H10BrF3N2O/c1-20-12-11(14)7-9(18-19-12)6-8-4-2-3-5-10(8)13(15,16)17/h2-5,7H,6H2,1H3 |
| InChIKey | AXHZQXDPSLKSFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |