About 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal
3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal (PubChem CID 117107564) has the molecular formula C13H17ClO2
and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal.
Molecular Properties
| Compound Name | 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal |
| PubChem CID | 117107564 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal |
| SMILES | Cc1c(C)c(C(C)CC=O)c(C)c(Cl)c1O |
| InChI | InChI=1S/C13H17ClO2/c1-7(5-6-15)11-8(2)9(3)13(16)12(14)10(11)4/h6-7,16H,5H2,1-4H3 |
| InChIKey | VPEOUBCZBGBXTA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal?
The IUPAC name of 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal (CID 117107564) is 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal.
What is the SMILES notation for 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal?
The canonical SMILES for 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal is Cc1c(C)c(C(C)CC=O)c(C)c(Cl)c1O.
What is the InChIKey of 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal?
The InChIKey is VPEOUBCZBGBXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO2/c1-7(5-6-15)11-8(2)9(3)13(16)12(14)10(11)4/h6-7,16H,5H2,1-4H3.
What are the key properties of 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal?
3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal has a molecular weight of 240.73 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-4-hydroxy-2,5,6-trimethylphenyl)butanal is sourced from PubChem (CID 117107564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).