C19H26BN3O5 — CID 11710784
[(1R)-1-[[(2S,3R)-3-hydroxy-2-(quinoline-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 11710784) has the molecular formula C19H26BN3O5 and a molecular weight of 387.25 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-3-hydroxy-2-(quinoline-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-(quinoline-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 11710784 |
| Molecular Formula | C19H26BN3O5 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-(quinoline-2-carbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1ccc2ccccc2n1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C19H26BN3O5/c1-11(2)10-16(20(27)28)22-19(26)17(12(3)24)23-18(25)15-9-8-13-6-4-5-7-14(13)21-15/h4-9,11-12,16-17,24,27-28H,10H2,1-3H3,(H,22,26)(H,23,25)/t12-,16+,17+/m1/s1 |
| InChIKey | FJKDCVDXHQLKNK-DQYPLSBCSA-N |
| XLogP | 0.26 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|