About 5-fluoro-1,2-benzoxazol-6-amine
5-fluoro-1,2-benzoxazol-6-amine (PubChem CID 117110014) has the molecular formula C7H5FN2O
and a molecular weight of 152.13 g/mol. Its IUPAC name is 5-fluoro-1,2-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 5-fluoro-1,2-benzoxazol-6-amine |
| PubChem CID | 117110014 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 5-fluoro-1,2-benzoxazol-6-amine |
| SMILES | Nc1cc2oncc2cc1F |
| InChI | InChI=1S/C7H5FN2O/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,9H2 |
| InChIKey | SMRLWEHWXFMUDC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1,2-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,2-benzoxazol-6-amine?
The IUPAC name of 5-fluoro-1,2-benzoxazol-6-amine (CID 117110014) is 5-fluoro-1,2-benzoxazol-6-amine.
What is the SMILES notation for 5-fluoro-1,2-benzoxazol-6-amine?
The canonical SMILES for 5-fluoro-1,2-benzoxazol-6-amine is Nc1cc2oncc2cc1F.
What is the InChIKey of 5-fluoro-1,2-benzoxazol-6-amine?
The InChIKey is SMRLWEHWXFMUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,9H2.
What are the key properties of 5-fluoro-1,2-benzoxazol-6-amine?
5-fluoro-1,2-benzoxazol-6-amine has a molecular weight of 152.13 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,2-benzoxazol-6-amine is sourced from PubChem (CID 117110014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).