About (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine
(5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine (PubChem CID 117110094) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine |
| PubChem CID | 117110094 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine |
| SMILES | COc1ccc2onc(C)c2c1CN |
| InChI | InChI=1S/C10H12N2O2/c1-6-10-7(5-11)8(13-2)3-4-9(10)14-12-6/h3-4H,5,11H2,1-2H3 |
| InChIKey | PDWHWKCWJIIOKR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine?
The IUPAC name of (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine (CID 117110094) is (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine.
What is the SMILES notation for (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine?
The canonical SMILES for (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine is COc1ccc2onc(C)c2c1CN.
What is the InChIKey of (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine?
The InChIKey is PDWHWKCWJIIOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-6-10-7(5-11)8(13-2)3-4-9(10)14-12-6/h3-4H,5,11H2,1-2H3.
What are the key properties of (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine?
(5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine has a molecular weight of 192.22 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-3-methyl-1,2-benzoxazol-4-yl)methanamine is sourced from PubChem (CID 117110094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).