7-methoxy-2,3-dimethylindazole-6-carboxylic acid

C11H12N2O3 — CID 117110319

IUPAC7-methoxy-2,3-dimethylindazole-6-carboxylic acid
SMILESCOc1c(C(=O)O)ccc2c(C)n(C)nc12
InChIInChI=1S/C11H12N2O3/c1-6-7-4-5-8(11(14)15)10(16-3)9(7)12-13(6)2/h4-5H,1-3H3,(H,14,15)
InChIKeyYYBSOIDPVQLSDX-UHFFFAOYSA-N
MW220.23 g/mol
LogP1.59
Rot. Bonds2

About 7-methoxy-2,3-dimethylindazole-6-carboxylic acid

7-methoxy-2,3-dimethylindazole-6-carboxylic acid (PubChem CID 117110319) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 7-methoxy-2,3-dimethylindazole-6-carboxylic acid.

Molecular Properties

Compound Name7-methoxy-2,3-dimethylindazole-6-carboxylic acid
PubChem CID117110319
Molecular FormulaC11H12N2O3
Molecular Weight220.23 g/mol
Exact Mass220.08
IUPAC Name7-methoxy-2,3-dimethylindazole-6-carboxylic acid
SMILESCOc1c(C(=O)O)ccc2c(C)n(C)nc12
InChIInChI=1S/C11H12N2O3/c1-6-7-4-5-8(11(14)15)10(16-3)9(7)12-13(6)2/h4-5H,1-3H3,(H,14,15)
InChIKeyYYBSOIDPVQLSDX-UHFFFAOYSA-N
XLogP1.59
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.23
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 7-methoxy-2,3-dimethylindazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methoxy-2,3-dimethylindazole-6-carboxylic acid?
The IUPAC name of 7-methoxy-2,3-dimethylindazole-6-carboxylic acid (CID 117110319) is 7-methoxy-2,3-dimethylindazole-6-carboxylic acid.
What is the SMILES notation for 7-methoxy-2,3-dimethylindazole-6-carboxylic acid?
The canonical SMILES for 7-methoxy-2,3-dimethylindazole-6-carboxylic acid is COc1c(C(=O)O)ccc2c(C)n(C)nc12.
What is the InChIKey of 7-methoxy-2,3-dimethylindazole-6-carboxylic acid?
The InChIKey is YYBSOIDPVQLSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-6-7-4-5-8(11(14)15)10(16-3)9(7)12-13(6)2/h4-5H,1-3H3,(H,14,15).
What are the key properties of 7-methoxy-2,3-dimethylindazole-6-carboxylic acid?
7-methoxy-2,3-dimethylindazole-6-carboxylic acid has a molecular weight of 220.23 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,3-dimethylindazole-6-carboxylic acid is sourced from PubChem (CID 117110319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).