About 7-bromo-2,3-dimethylindazole-5-carbaldehyde
7-bromo-2,3-dimethylindazole-5-carbaldehyde (PubChem CID 117110361) has the molecular formula C10H9BrN2O
and a molecular weight of 253.10 g/mol. Its IUPAC name is 7-bromo-2,3-dimethylindazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 7-bromo-2,3-dimethylindazole-5-carbaldehyde |
| PubChem CID | 117110361 |
| Molecular Formula | C10H9BrN2O |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 7-bromo-2,3-dimethylindazole-5-carbaldehyde |
| SMILES | Cc1c2cc(C=O)cc(Br)c2nn1C |
| InChI | InChI=1S/C10H9BrN2O/c1-6-8-3-7(5-14)4-9(11)10(8)12-13(6)2/h3-5H,1-2H3 |
| InChIKey | MMMGOBHBWGSZQB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2,3-dimethylindazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3-dimethylindazole-5-carbaldehyde?
The IUPAC name of 7-bromo-2,3-dimethylindazole-5-carbaldehyde (CID 117110361) is 7-bromo-2,3-dimethylindazole-5-carbaldehyde.
What is the SMILES notation for 7-bromo-2,3-dimethylindazole-5-carbaldehyde?
The canonical SMILES for 7-bromo-2,3-dimethylindazole-5-carbaldehyde is Cc1c2cc(C=O)cc(Br)c2nn1C.
What is the InChIKey of 7-bromo-2,3-dimethylindazole-5-carbaldehyde?
The InChIKey is MMMGOBHBWGSZQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O/c1-6-8-3-7(5-14)4-9(11)10(8)12-13(6)2/h3-5H,1-2H3.
What are the key properties of 7-bromo-2,3-dimethylindazole-5-carbaldehyde?
7-bromo-2,3-dimethylindazole-5-carbaldehyde has a molecular weight of 253.10 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3-dimethylindazole-5-carbaldehyde is sourced from PubChem (CID 117110361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).