C19H26F3N3O3 — CID 11711079
tert-butyl 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 11711079) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is tert-butyl 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 11711079 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | tert-butyl 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(C3CC3)nc(OCCC(F)(F)F)c2CC1 |
| InChI | InChI=1S/C19H26F3N3O3/c1-18(2,3)28-17(26)25-9-6-13-14(7-10-25)23-15(12-4-5-12)24-16(13)27-11-8-19(20,21)22/h12H,4-11H2,1-3H3 |
| InChIKey | PMBDDXXZVLRZAG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |