C15H24N2O2 — CID 117110963
tert-butyl N-[5-(1-aminoethyl)-2,3-dimethylphenyl]carbamate (PubChem CID 117110963) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl N-[5-(1-aminoethyl)-2,3-dimethylphenyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-aminoethyl)-2,3-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 117110963 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl N-[5-(1-aminoethyl)-2,3-dimethylphenyl]carbamate |
| SMILES | Cc1cc(C(C)N)cc(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C15H24N2O2/c1-9-7-12(11(3)16)8-13(10(9)2)17-14(18)19-15(4,5)6/h7-8,11H,16H2,1-6H3,(H,17,18) |
| InChIKey | SWBWGUASEMPNFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |