About O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine
O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine (PubChem CID 117111216) has the molecular formula C9H12F2N2O
and a molecular weight of 202.20 g/mol. Its IUPAC name is O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine |
| PubChem CID | 117111216 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine |
| SMILES | CN(C)c1cc(F)c(F)cc1CON |
| InChI | InChI=1S/C9H12F2N2O/c1-13(2)9-4-8(11)7(10)3-6(9)5-14-12/h3-4H,5,12H2,1-2H3 |
| InChIKey | GSIGRIFMVRBCDX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine?
The IUPAC name of O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine (CID 117111216) is O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine.
What is the SMILES notation for O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine?
The canonical SMILES for O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine is CN(C)c1cc(F)c(F)cc1CON.
What is the InChIKey of O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine?
The InChIKey is GSIGRIFMVRBCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O/c1-13(2)9-4-8(11)7(10)3-6(9)5-14-12/h3-4H,5,12H2,1-2H3.
What are the key properties of O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine?
O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine has a molecular weight of 202.20 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[2-(dimethylamino)-4,5-difluorophenyl]methyl]hydroxylamine is sourced from PubChem (CID 117111216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).