About 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol
4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol (PubChem CID 117111890) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol.
Molecular Properties
| Compound Name | 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol |
| PubChem CID | 117111890 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol |
| SMILES | Cc1cc(C(C)(C)N)c(C)c(C)c1O |
| InChI | InChI=1S/C12H19NO/c1-7-6-10(12(4,5)13)8(2)9(3)11(7)14/h6,14H,13H2,1-5H3 |
| InChIKey | PELWQAMPQPJXNV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol?
The IUPAC name of 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol (CID 117111890) is 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol.
What is the SMILES notation for 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol?
The canonical SMILES for 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol is Cc1cc(C(C)(C)N)c(C)c(C)c1O.
What is the InChIKey of 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol?
The InChIKey is PELWQAMPQPJXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-7-6-10(12(4,5)13)8(2)9(3)11(7)14/h6,14H,13H2,1-5H3.
What are the key properties of 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol?
4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol has a molecular weight of 193.29 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropan-2-yl)-2,3,6-trimethylphenol is sourced from PubChem (CID 117111890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).