C11H13BrF3N — CID 117112045
1-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpropan-2-amine (PubChem CID 117112045) has the molecular formula C11H13BrF3N and a molecular weight of 296.13 g/mol. Its IUPAC name is 1-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpropan-2-amine.
| Compound Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 117112045 |
| Molecular Formula | C11H13BrF3N |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(N)Cc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H13BrF3N/c1-10(2,16)6-7-3-4-8(5-9(7)12)11(13,14)15/h3-5H,6,16H2,1-2H3 |
| InChIKey | ZOFHJHBABWDLLS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |