C22H37NO4Si — CID 11711218
tert-butyl N-[(Z,1S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1-phenylpent-2-enyl]carbamate (PubChem CID 11711218) has the molecular formula C22H37NO4Si and a molecular weight of 407.63 g/mol. Its IUPAC name is tert-butyl N-[(Z,1S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1-phenylpent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z,1S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1-phenylpent-2-enyl]carbamate |
|---|---|
| PubChem CID | 11711218 |
| Molecular Formula | C22H37NO4Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | tert-butyl N-[(Z,1S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1-phenylpent-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](/C=C\[C@@H](O)CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO4Si/c1-21(2,3)27-20(25)23-19(17-12-10-9-11-13-17)15-14-18(24)16-26-28(7,8)22(4,5)6/h9-15,18-19,24H,16H2,1-8H3,(H,23,25)/b15-14-/t18-,19+/m1/s1 |
| InChIKey | AXWQEIJBHRJDLV-LOBVBGPYSA-N |
| XLogP | 5.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|